C18H34 — CID 143700143
(1Z)-1,2,3,3,5,8,10,10-octamethylcyclodecene (PubChem CID 143700143) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is (1Z)-1,2,3,3,5,8,10,10-octamethylcyclodecene.
| Compound Name | (1Z)-1,2,3,3,5,8,10,10-octamethylcyclodecene |
|---|---|
| PubChem CID | 143700143 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | (1Z)-1,2,3,3,5,8,10,10-octamethylcyclodecene |
| SMILES | C/C1=C(\C)C(C)(C)CC(C)CCC(C)CC1(C)C |
| InChI | InChI=1S/C18H34/c1-13-9-10-14(2)12-18(7,8)16(4)15(3)17(5,6)11-13/h13-14H,9-12H2,1-8H3/b16-15- |
| InChIKey | DTYSBLFNUBVTTG-NXVVXOECSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|