C11H3F19O4 — CID 143700248
1,1-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]prop-1-ene (PubChem CID 143700248) has the molecular formula C11H3F19O4 and a molecular weight of 560.10 g/mol. Its IUPAC name is 1,1-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]prop-1-ene.
| Compound Name | 1,1-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 143700248 |
| Molecular Formula | C11H3F19O4 |
| Molecular Weight | 560.10 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | 1,1-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]ethoxy]prop-1-ene |
| SMILES | CC(OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F)=C(F)F |
| InChI | InChI=1S/C11H3F19O4/c1-2(3(12)13)31-6(19,20)7(21,22)33-10(27,28)11(29,30)34-9(25,26)8(23,24)32-5(17,18)4(14,15)16/h1H3 |
| InChIKey | LYCHKCXFRNAMFO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.10 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|