C24H35N5O2 — CID 143700670
(E)-N-cyclohexyloxy-3-[3-[1-(2-phenylethylamino)propan-2-ylimino]-2,4-dihydro-1H-pyrazin-6-yl]prop-2-enamide (PubChem CID 143700670) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is (E)-N-cyclohexyloxy-3-[3-[1-(2-phenylethylamino)propan-2-ylimino]-2,4-dihydro-1H-pyrazin-6-yl]prop-2-enamide.
| Compound Name | (E)-N-cyclohexyloxy-3-[3-[1-(2-phenylethylamino)propan-2-ylimino]-2,4-dihydro-1H-pyrazin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 143700670 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | (E)-N-cyclohexyloxy-3-[3-[1-(2-phenylethylamino)propan-2-ylimino]-2,4-dihydro-1H-pyrazin-6-yl]prop-2-enamide |
| SMILES | CC(CNCCc1ccccc1)/N=C1\CNC(/C=C/C(=O)NOC2CCCCC2)=CN1 |
| InChI | InChI=1S/C24H35N5O2/c1-19(16-25-15-14-20-8-4-2-5-9-20)28-23-18-26-21(17-27-23)12-13-24(30)29-31-22-10-6-3-7-11-22/h2,4-5,8-9,12-13,17,19,22,25-26H,3,6-7,10-11,14-16,18H2,1H3,(H,27,28)(H,29,30)/b13-12+ |
| InChIKey | NGDLAEZTSSEPGE-OUKQBFOZSA-N |
| XLogP | 2.58 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|