About 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one
2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one (PubChem CID 143700855) has the molecular formula C12H16N2OSi
and a molecular weight of 232.36 g/mol. Its IUPAC name is 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one |
| PubChem CID | 143700855 |
| Molecular Formula | C12H16N2OSi |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one |
| SMILES | C[Si](C)(C)c1ccc(C2=NCC(=O)N2)cc1 |
| InChI | InChI=1S/C12H16N2OSi/c1-16(2,3)10-6-4-9(5-7-10)12-13-8-11(15)14-12/h4-7H,8H2,1-3H3,(H,13,14,15) |
| InChIKey | GTMISJRRYLENDW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one (CID 143700855) is 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one is C[Si](C)(C)c1ccc(C2=NCC(=O)N2)cc1.
What is the InChIKey of 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one?
The InChIKey is GTMISJRRYLENDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2OSi/c1-16(2,3)10-6-4-9(5-7-10)12-13-8-11(15)14-12/h4-7H,8H2,1-3H3,(H,13,14,15).
What are the key properties of 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one?
2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one has a molecular weight of 232.36 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-trimethylsilylphenyl)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 143700855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).