C16H21FN2O — CID 143701059
N-[(2Z,5E)-5-fluoroocta-2,5-dienyl]-2-methanimidoyl-4-methoxyaniline (PubChem CID 143701059) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[(2Z,5E)-5-fluoroocta-2,5-dienyl]-2-methanimidoyl-4-methoxyaniline.
| Compound Name | N-[(2Z,5E)-5-fluoroocta-2,5-dienyl]-2-methanimidoyl-4-methoxyaniline |
|---|---|
| PubChem CID | 143701059 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[(2Z,5E)-5-fluoroocta-2,5-dienyl]-2-methanimidoyl-4-methoxyaniline |
| SMILES | [H]/N=C/c1cc(OC)ccc1NC/C=C\C/C(F)=C\CC |
| InChI | InChI=1S/C16H21FN2O/c1-3-6-14(17)7-4-5-10-19-16-9-8-15(20-2)11-13(16)12-18/h4-6,8-9,11-12,18-19H,3,7,10H2,1-2H3/b5-4-,14-6+,18-12+ |
| InChIKey | LBFMKIGRPPVSGK-HYULCXRNSA-N |
| XLogP | 4.31 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|