C14H24N2O — CID 143701343
ethane;2-ethyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,4-oxadiazole (PubChem CID 143701343) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is ethane;2-ethyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,4-oxadiazole.
| Compound Name | ethane;2-ethyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143701343 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | ethane;2-ethyl-5-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,4-oxadiazole |
| SMILES | C=C/C=C(\C=C)c1nnc(CC)o1.CC.CC |
| InChI | InChI=1S/C10H12N2O.2C2H6/c1-4-7-8(5-2)10-12-11-9(6-3)13-10;2*1-2/h4-5,7H,1-2,6H2,3H3;2*1-2H3/b8-7+;; |
| InChIKey | ASOVPVLYBLCUQC-MIIBGCIDSA-N |
| XLogP | 4.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|