About 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione
9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione (PubChem CID 14370160) has the molecular formula C22H30ClN5O2
and a molecular weight of 431.97 g/mol. Its IUPAC name is 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione.
Molecular Properties
| Compound Name | 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione |
| PubChem CID | 14370160 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione |
| SMILES | O=C1C2CC(C(=O)N1CCCCN1CCN(c3cncc(Cl)n3)CC1)C1CCCC21 |
| InChI | InChI=1S/C22H30ClN5O2/c23-19-13-24-14-20(25-19)27-10-8-26(9-11-27)6-1-2-7-28-21(29)17-12-18(22(28)30)16-5-3-4-15(16)17/h13-18H,1-12H2 |
| InChIKey | QRECIUUBYLTNQX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione?
The IUPAC name of 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione (CID 14370160) is 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione.
What is the SMILES notation for 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione?
The canonical SMILES for 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione is O=C1C2CC(C(=O)N1CCCCN1CCN(c3cncc(Cl)n3)CC1)C1CCCC21.
What is the InChIKey of 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione?
The InChIKey is QRECIUUBYLTNQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30ClN5O2/c23-19-13-24-14-20(25-19)27-10-8-26(9-11-27)6-1-2-7-28-21(29)17-12-18(22(28)30)16-5-3-4-15(16)17/h13-18H,1-12H2.
What are the key properties of 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione?
9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione has a molecular weight of 431.97 g/mol, XLogP of 2.45, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-[4-(6-chloropyrazin-2-yl)piperazin-1-yl]butyl]-9-azatricyclo[5.3.1.02,6]undecane-8,10-dione is sourced from PubChem (CID 14370160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).