C31H50NO9P — CID 143701641
tert-butyl N-[2-hydroxy-2-[3-(hydroxymethyl)-4-phosphonooxyphenyl]ethyl]-N-[6-[4-(4-methylcyclohexa-1,5-dien-1-yl)butoxy]hexyl]carbamate (PubChem CID 143701641) has the molecular formula C31H50NO9P and a molecular weight of 611.71 g/mol. Its IUPAC name is tert-butyl N-[2-hydroxy-2-[3-(hydroxymethyl)-4-phosphonooxyphenyl]ethyl]-N-[6-[4-(4-methylcyclohexa-1,5-dien-1-yl)butoxy]hexyl]carbamate.
| Compound Name | tert-butyl N-[2-hydroxy-2-[3-(hydroxymethyl)-4-phosphonooxyphenyl]ethyl]-N-[6-[4-(4-methylcyclohexa-1,5-dien-1-yl)butoxy]hexyl]carbamate |
|---|---|
| PubChem CID | 143701641 |
| Molecular Formula | C31H50NO9P |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | tert-butyl N-[2-hydroxy-2-[3-(hydroxymethyl)-4-phosphonooxyphenyl]ethyl]-N-[6-[4-(4-methylcyclohexa-1,5-dien-1-yl)butoxy]hexyl]carbamate |
| SMILES | CC1C=CC(CCCCOCCCCCCN(CC(O)c2ccc(OP(=O)(O)O)c(CO)c2)C(=O)OC(C)(C)C)=CC1 |
| InChI | InChI=1S/C31H50NO9P/c1-24-12-14-25(15-13-24)11-7-10-20-39-19-9-6-5-8-18-32(30(35)40-31(2,3)4)22-28(34)26-16-17-29(27(21-26)23-33)41-42(36,37)38/h12,14-17,21,24,28,33-34H,5-11,13,18-20,22-23H2,1-4H3,(H2,36,37,38) |
| InChIKey | XTTZANXVAABSDM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|