C26H45N3O4 — CID 143702530
ethane;ethyl 4-[2-(dimethylamino)-N-ethyl-4-formyl-5-methoxyanilino]butanoate;(2Z)-4-methylpenta-2,4-dien-2-amine (PubChem CID 143702530) has the molecular formula C26H45N3O4 and a molecular weight of 463.66 g/mol. Its IUPAC name is ethane;ethyl 4-[2-(dimethylamino)-N-ethyl-4-formyl-5-methoxyanilino]butanoate;(2Z)-4-methylpenta-2,4-dien-2-amine.
| Compound Name | ethane;ethyl 4-[2-(dimethylamino)-N-ethyl-4-formyl-5-methoxyanilino]butanoate;(2Z)-4-methylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 143702530 |
| Molecular Formula | C26H45N3O4 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | ethane;ethyl 4-[2-(dimethylamino)-N-ethyl-4-formyl-5-methoxyanilino]butanoate;(2Z)-4-methylpenta-2,4-dien-2-amine |
| SMILES | C=C(C)/C=C(/C)N.CC.CCOC(=O)CCCN(CC)c1cc(OC)c(C=O)cc1N(C)C |
| InChI | InChI=1S/C18H28N2O4.C6H11N.C2H6/c1-6-20(10-8-9-18(22)24-7-2)16-12-17(23-5)14(13-21)11-15(16)19(3)4;1-5(2)4-6(3)7;1-2/h11-13H,6-10H2,1-5H3;4H,1,7H2,2-3H3;1-2H3/b;6-4-; |
| InChIKey | BVWCONGGKNMCFS-GONQOWGMSA-N |
| XLogP | 5.19 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|