C24H21F3N2O2 — CID 143702625
1-[2-[2-[[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxymethyl]-3H-benzimidazol-5-yl]phenyl]propan-1-one (PubChem CID 143702625) has the molecular formula C24H21F3N2O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-[2-[2-[[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxymethyl]-3H-benzimidazol-5-yl]phenyl]propan-1-one.
| Compound Name | 1-[2-[2-[[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxymethyl]-3H-benzimidazol-5-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 143702625 |
| Molecular Formula | C24H21F3N2O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[2-[2-[[(3Z)-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]oxymethyl]-3H-benzimidazol-5-yl]phenyl]propan-1-one |
| SMILES | C=C(/C=C\C(=C)C(F)(F)F)OCc1nc2ccc(-c3ccccc3C(=O)CC)cc2[nH]1 |
| InChI | InChI=1S/C24H21F3N2O2/c1-4-22(30)19-8-6-5-7-18(19)17-11-12-20-21(13-17)29-23(28-20)14-31-16(3)10-9-15(2)24(25,26)27/h5-13H,2-4,14H2,1H3,(H,28,29)/b10-9- |
| InChIKey | CLLYKFGDSBGARE-KTKRTIGZSA-N |
| XLogP | 6.53 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|