About ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one
ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 143702740) has the molecular formula C19H20F3NO3
and a molecular weight of 367.37 g/mol. Its IUPAC name is ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| PubChem CID | 143702740 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC.COc1ccc(N2C(=O)OCC2c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H14F3NO3.C2H6/c1-23-14-7-5-13(6-8-14)21-15(10-24-16(21)22)11-3-2-4-12(9-11)17(18,19)20;1-2/h2-9,15H,10H2,1H3;1-2H3 |
| InChIKey | SNOVPCSFAINIOZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
The IUPAC name of ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (CID 143702740) is ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
The canonical SMILES for ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one is CC.COc1ccc(N2C(=O)OCC2c2cccc(C(F)(F)F)c2)cc1.
What is the InChIKey of ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
The InChIKey is SNOVPCSFAINIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3NO3.C2H6/c1-23-14-7-5-13(6-8-14)21-15(10-24-16(21)22)11-3-2-4-12(9-11)17(18,19)20;1-2/h2-9,15H,10H2,1H3;1-2H3.
What are the key properties of ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one?
ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one has a molecular weight of 367.37 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 143702740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).