About 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol
1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol (PubChem CID 143702908) has the molecular formula C24H49NO
and a molecular weight of 367.66 g/mol. Its IUPAC name is 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol.
Molecular Properties
| Compound Name | 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol |
| PubChem CID | 143702908 |
| Molecular Formula | C24H49NO |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 367.38 |
| IUPAC Name | 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol |
| SMILES | CC1CCC(C)C1.CCC(CCCCC(C)O)CNC1CCC(C)CC1 |
| InChI | InChI=1S/C17H35NO.C7H14/c1-4-16(8-6-5-7-15(3)19)13-18-17-11-9-14(2)10-12-17;1-6-3-4-7(2)5-6/h14-19H,4-13H2,1-3H3;6-7H,3-5H2,1-2H3 |
| InChIKey | GKHOOOGNFHLCAG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol?
The IUPAC name of 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol (CID 143702908) is 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol.
What is the SMILES notation for 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol?
The canonical SMILES for 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol is CC1CCC(C)C1.CCC(CCCCC(C)O)CNC1CCC(C)CC1.
What is the InChIKey of 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol?
The InChIKey is GKHOOOGNFHLCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO.C7H14/c1-4-16(8-6-5-7-15(3)19)13-18-17-11-9-14(2)10-12-17;1-6-3-4-7(2)5-6/h14-19H,4-13H2,1-3H3;6-7H,3-5H2,1-2H3.
What are the key properties of 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol?
1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol has a molecular weight of 367.66 g/mol, XLogP of 6.56, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylcyclopentane;7-[[(4-methylcyclohexyl)amino]methyl]nonan-2-ol is sourced from PubChem (CID 143702908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).