C11H12N2O3 — CID 143703164
methanamine;2-oxo-1H-quinoline-4-carboxylic acid (PubChem CID 143703164) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is methanamine;2-oxo-1H-quinoline-4-carboxylic acid.
| Compound Name | methanamine;2-oxo-1H-quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 143703164 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methanamine;2-oxo-1H-quinoline-4-carboxylic acid |
| SMILES | CN.O=C(O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C10H7NO3.CH5N/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9;1-2/h1-5H,(H,11,12)(H,13,14);2H2,1H3 |
| InChIKey | GTCIISMFHLUXIR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |