About methanamine;2-oxo-1H-quinoline-4-carboxylic acid
methanamine;2-oxo-1H-quinoline-4-carboxylic acid (PubChem CID 143703164) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is methanamine;2-oxo-1H-quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | methanamine;2-oxo-1H-quinoline-4-carboxylic acid |
| PubChem CID | 143703164 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methanamine;2-oxo-1H-quinoline-4-carboxylic acid |
| SMILES | CN.O=C(O)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C10H7NO3.CH5N/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9;1-2/h1-5H,(H,11,12)(H,13,14);2H2,1H3 |
| InChIKey | GTCIISMFHLUXIR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanamine;2-oxo-1H-quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-oxo-1H-quinoline-4-carboxylic acid?
The IUPAC name of methanamine;2-oxo-1H-quinoline-4-carboxylic acid (CID 143703164) is methanamine;2-oxo-1H-quinoline-4-carboxylic acid.
What is the SMILES notation for methanamine;2-oxo-1H-quinoline-4-carboxylic acid?
The canonical SMILES for methanamine;2-oxo-1H-quinoline-4-carboxylic acid is CN.O=C(O)c1cc(=O)[nH]c2ccccc12.
What is the InChIKey of methanamine;2-oxo-1H-quinoline-4-carboxylic acid?
The InChIKey is GTCIISMFHLUXIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3.CH5N/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9;1-2/h1-5H,(H,11,12)(H,13,14);2H2,1H3.
What are the key properties of methanamine;2-oxo-1H-quinoline-4-carboxylic acid?
methanamine;2-oxo-1H-quinoline-4-carboxylic acid has a molecular weight of 220.23 g/mol, XLogP of 0.80, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-oxo-1H-quinoline-4-carboxylic acid is sourced from PubChem (CID 143703164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).