About ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide
ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide (PubChem CID 143703270) has the molecular formula C17H39N5
and a molecular weight of 313.53 g/mol. Its IUPAC name is ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide.
Molecular Properties
| Compound Name | ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide |
| PubChem CID | 143703270 |
| Molecular Formula | C17H39N5 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.32 |
| IUPAC Name | ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide |
| SMILES | C=C/N=C/N(C)CCN1CCN(C(C)C)CC1.CC.CCN |
| InChI | InChI=1S/C13H26N4.C2H7N.C2H6/c1-5-14-12-15(4)6-7-16-8-10-17(11-9-16)13(2)3;1-2-3;1-2/h5,12-13H,1,6-11H2,2-4H3;2-3H2,1H3;1-2H3/b14-12+;; |
| InChIKey | MNYZWQYWKNEZJG-QHXCTMFKSA-N |
| XLogP | 2.11 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide?
The IUPAC name of ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide (CID 143703270) is ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide.
What is the SMILES notation for ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide?
The canonical SMILES for ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide is C=C/N=C/N(C)CCN1CCN(C(C)C)CC1.CC.CCN.
What is the InChIKey of ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide?
The InChIKey is MNYZWQYWKNEZJG-QHXCTMFKSA-N. The full InChI is InChI=1S/C13H26N4.C2H7N.C2H6/c1-5-14-12-15(4)6-7-16-8-10-17(11-9-16)13(2)3;1-2-3;1-2/h5,12-13H,1,6-11H2,2-4H3;2-3H2,1H3;1-2H3/b14-12+;;.
What are the key properties of ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide?
ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide has a molecular weight of 313.53 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;ethane;N'-ethenyl-N-methyl-N-[2-(4-propan-2-ylpiperazin-1-yl)ethyl]methanimidamide is sourced from PubChem (CID 143703270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).