C18H33NS — CID 143703333
ethane;4-methyl-5-[(5Z)-5-methylocta-2,5-dienyl]-2-propan-2-yl-2,3-dihydro-1,3-thiazole (PubChem CID 143703333) has the molecular formula C18H33NS and a molecular weight of 295.54 g/mol. Its IUPAC name is ethane;4-methyl-5-[(5Z)-5-methylocta-2,5-dienyl]-2-propan-2-yl-2,3-dihydro-1,3-thiazole.
| Compound Name | ethane;4-methyl-5-[(5Z)-5-methylocta-2,5-dienyl]-2-propan-2-yl-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 143703333 |
| Molecular Formula | C18H33NS |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | ethane;4-methyl-5-[(5Z)-5-methylocta-2,5-dienyl]-2-propan-2-yl-2,3-dihydro-1,3-thiazole |
| SMILES | CC.CC/C=C(/C)CC=CCC1=C(C)NC(C(C)C)S1 |
| InChI | InChI=1S/C16H27NS.C2H6/c1-6-9-13(4)10-7-8-11-15-14(5)17-16(18-15)12(2)3;1-2/h7-9,12,16-17H,6,10-11H2,1-5H3;1-2H3/b8-7?,13-9-; |
| InChIKey | HKPLKYUAQQLDLY-DDANCXNZSA-N |
| XLogP | 6.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|