C18H26F3N — CID 143703456
4-methyl-N-[(1E)-6-methyl-3-(trifluoromethyl)nona-1,3-dienyl]cyclohexa-2,4-dien-1-amine (PubChem CID 143703456) has the molecular formula C18H26F3N and a molecular weight of 313.41 g/mol. Its IUPAC name is 4-methyl-N-[(1E)-6-methyl-3-(trifluoromethyl)nona-1,3-dienyl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 4-methyl-N-[(1E)-6-methyl-3-(trifluoromethyl)nona-1,3-dienyl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143703456 |
| Molecular Formula | C18H26F3N |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-methyl-N-[(1E)-6-methyl-3-(trifluoromethyl)nona-1,3-dienyl]cyclohexa-2,4-dien-1-amine |
| SMILES | CCCC(C)CC=C(/C=C/NC1C=CC(C)=CC1)C(F)(F)F |
| InChI | InChI=1S/C18H26F3N/c1-4-5-14(2)6-9-16(18(19,20)21)12-13-22-17-10-7-15(3)8-11-17/h7-10,12-14,17,22H,4-6,11H2,1-3H3/b13-12+,16-9? |
| InChIKey | KTBLTMVWTBIHIE-WNSZQWPYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|