C18H34F3N — CID 143703538
(E)-6,11-diethyl-1,1,1-trifluoro-8-methyltridec-8-en-3-amine (PubChem CID 143703538) has the molecular formula C18H34F3N and a molecular weight of 321.47 g/mol. Its IUPAC name is (E)-6,11-diethyl-1,1,1-trifluoro-8-methyltridec-8-en-3-amine.
| Compound Name | (E)-6,11-diethyl-1,1,1-trifluoro-8-methyltridec-8-en-3-amine |
|---|---|
| PubChem CID | 143703538 |
| Molecular Formula | C18H34F3N |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.26 |
| IUPAC Name | (E)-6,11-diethyl-1,1,1-trifluoro-8-methyltridec-8-en-3-amine |
| SMILES | CCC(CC)C/C=C(\C)CC(CC)CCC(N)CC(F)(F)F |
| InChI | InChI=1S/C18H34F3N/c1-5-15(6-2)9-8-14(4)12-16(7-3)10-11-17(22)13-18(19,20)21/h8,15-17H,5-7,9-13,22H2,1-4H3/b14-8+ |
| InChIKey | RFTUBSMEBVEOME-RIYZIHGNSA-N |
| XLogP | 6.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|