C20H20N2O2 — CID 143703661
[5-[(1E)-3-(hydroxyamino)buta-1,3-dienyl]-1,3-dihydroisoindol-2-yl]-(3-methylphenyl)methanone (PubChem CID 143703661) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is [5-[(1E)-3-(hydroxyamino)buta-1,3-dienyl]-1,3-dihydroisoindol-2-yl]-(3-methylphenyl)methanone.
| Compound Name | [5-[(1E)-3-(hydroxyamino)buta-1,3-dienyl]-1,3-dihydroisoindol-2-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 143703661 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [5-[(1E)-3-(hydroxyamino)buta-1,3-dienyl]-1,3-dihydroisoindol-2-yl]-(3-methylphenyl)methanone |
| SMILES | C=C(/C=C/c1ccc2c(c1)CN(C(=O)c1cccc(C)c1)C2)NO |
| InChI | InChI=1S/C20H20N2O2/c1-14-4-3-5-17(10-14)20(23)22-12-18-9-8-16(11-19(18)13-22)7-6-15(2)21-24/h3-11,21,24H,2,12-13H2,1H3/b7-6+ |
| InChIKey | ZPXKUYZRJLCPBJ-VOTSOKGWSA-N |
| XLogP | 3.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|