About 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol
1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol (PubChem CID 143703948) has the molecular formula C13H16S
and a molecular weight of 204.34 g/mol. Its IUPAC name is 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol.
Molecular Properties
| Compound Name | 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol |
| PubChem CID | 143703948 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol |
| SMILES | C=C1Cc2ccc(CC(C)S)cc2C1 |
| InChI | InChI=1S/C13H16S/c1-9-5-12-4-3-11(7-10(2)14)8-13(12)6-9/h3-4,8,10,14H,1,5-7H2,2H3 |
| InChIKey | XROLTCAGXYITCQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol?
The IUPAC name of 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol (CID 143703948) is 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol.
What is the SMILES notation for 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol?
The canonical SMILES for 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol is C=C1Cc2ccc(CC(C)S)cc2C1.
What is the InChIKey of 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol?
The InChIKey is XROLTCAGXYITCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16S/c1-9-5-12-4-3-11(7-10(2)14)8-13(12)6-9/h3-4,8,10,14H,1,5-7H2,2H3.
What are the key properties of 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol?
1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol has a molecular weight of 204.34 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylidene-1,3-dihydroinden-5-yl)propane-2-thiol is sourced from PubChem (CID 143703948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).