C35H58O3 — CID 143705174
[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-1-yl] octanoate (PubChem CID 143705174) has the molecular formula C35H58O3 and a molecular weight of 526.85 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-1-yl] octanoate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-1-yl] octanoate |
|---|---|
| PubChem CID | 143705174 |
| Molecular Formula | C35H58O3 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.44 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-1-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1=C[C@@H](O)CC2=CC[C@@H]3[C@H](CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]34)[C@]21C |
| InChI | InChI=1S/C35H58O3/c1-7-8-9-10-11-15-33(37)38-32-23-27(36)22-26-16-17-28-30-19-18-29(25(4)14-12-13-24(2)3)34(30,5)21-20-31(28)35(26,32)6/h16,23-25,27-31,36H,7-15,17-22H2,1-6H3/t25-,27+,28+,29-,30+,31+,34-,35+/m1/s1 |
| InChIKey | BURVAIDHHNSEGO-XKKIZWAMSA-N |
| XLogP | 9.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|