About 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine
6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine (PubChem CID 143705347) has the molecular formula C27H30N2
and a molecular weight of 382.55 g/mol. Its IUPAC name is 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine |
| PubChem CID | 143705347 |
| Molecular Formula | C27H30N2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine |
| SMILES | CC1CCCN(Cc2cccc3ccccc23)C1.Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C17H21N.C10H9N/c1-14-6-5-11-18(12-14)13-16-9-4-8-15-7-2-3-10-17(15)16;1-8-2-3-10-7-11-5-4-9(10)6-8/h2-4,7-10,14H,5-6,11-13H2,1H3;2-7H,1H3 |
| InChIKey | BHEZLRVQEXOOKY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine?
The IUPAC name of 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine (CID 143705347) is 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine.
What is the SMILES notation for 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine?
The canonical SMILES for 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine is CC1CCCN(Cc2cccc3ccccc23)C1.Cc1ccc2cnccc2c1.
What is the InChIKey of 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine?
The InChIKey is BHEZLRVQEXOOKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N.C10H9N/c1-14-6-5-11-18(12-14)13-16-9-4-8-15-7-2-3-10-17(15)16;1-8-2-3-10-7-11-5-4-9(10)6-8/h2-4,7-10,14H,5-6,11-13H2,1H3;2-7H,1H3.
What are the key properties of 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine?
6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine has a molecular weight of 382.55 g/mol, XLogP of 6.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylisoquinoline;3-methyl-1-(naphthalen-1-ylmethyl)piperidine is sourced from PubChem (CID 143705347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).