About 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine
6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine (PubChem CID 143705474) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine.
Molecular Properties
| Compound Name | 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine |
| PubChem CID | 143705474 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine |
| SMILES | CNC1CCCCC1.Nc1ccc2c(=O)[nH]ccc2c1 |
| InChI | InChI=1S/C9H8N2O.C7H15N/c10-7-1-2-8-6(5-7)3-4-11-9(8)12;1-8-7-5-3-2-4-6-7/h1-5H,10H2,(H,11,12);7-8H,2-6H2,1H3 |
| InChIKey | QBVJVTCJQXPLKU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine?
The IUPAC name of 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine (CID 143705474) is 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine.
What is the SMILES notation for 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine?
The canonical SMILES for 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine is CNC1CCCCC1.Nc1ccc2c(=O)[nH]ccc2c1.
What is the InChIKey of 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine?
The InChIKey is QBVJVTCJQXPLKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.C7H15N/c10-7-1-2-8-6(5-7)3-4-11-9(8)12;1-8-7-5-3-2-4-6-7/h1-5H,10H2,(H,11,12);7-8H,2-6H2,1H3.
What are the key properties of 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine?
6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine has a molecular weight of 273.38 g/mol, XLogP of 2.65, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2H-isoquinolin-1-one;N-methylcyclohexanamine is sourced from PubChem (CID 143705474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).