About ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline
ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline (PubChem CID 143705548) has the molecular formula C26H35NO
and a molecular weight of 377.57 g/mol. Its IUPAC name is ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline.
Molecular Properties
| Compound Name | ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline |
| PubChem CID | 143705548 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline |
| SMILES | CC.CC1CCC(Oc2ccc3cnccc3c2)CC1.CCc1ccccc1 |
| InChI | InChI=1S/C16H19NO.C8H10.C2H6/c1-12-2-5-15(6-3-12)18-16-7-4-14-11-17-9-8-13(14)10-16;1-2-8-6-4-3-5-7-8;1-2/h4,7-12,15H,2-3,5-6H2,1H3;3-7H,2H2,1H3;1-2H3 |
| InChIKey | WDIKPFSRMRAEPC-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline?
The IUPAC name of ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline (CID 143705548) is ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline.
What is the SMILES notation for ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline?
The canonical SMILES for ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline is CC.CC1CCC(Oc2ccc3cnccc3c2)CC1.CCc1ccccc1.
What is the InChIKey of ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline?
The InChIKey is WDIKPFSRMRAEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO.C8H10.C2H6/c1-12-2-5-15(6-3-12)18-16-7-4-14-11-17-9-8-13(14)10-16;1-2-8-6-4-3-5-7-8;1-2/h4,7-12,15H,2-3,5-6H2,1H3;3-7H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline?
ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline has a molecular weight of 377.57 g/mol, XLogP of 7.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethylbenzene;6-(4-methylcyclohexyl)oxyisoquinoline is sourced from PubChem (CID 143705548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).