About 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene
1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene (PubChem CID 143705761) has the molecular formula C21H32ClN3O
and a molecular weight of 377.96 g/mol. Its IUPAC name is 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene.
Molecular Properties
| Compound Name | 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene |
| PubChem CID | 143705761 |
| Molecular Formula | C21H32ClN3O |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene |
| SMILES | C=C1CCC(=O)N1CCCNC1CCC(CN)CC1.Clc1ccccc1 |
| InChI | InChI=1S/C15H27N3O.C6H5Cl/c1-12-3-8-15(19)18(12)10-2-9-17-14-6-4-13(11-16)5-7-14;7-6-4-2-1-3-5-6/h13-14,17H,1-11,16H2;1-5H |
| InChIKey | KEYVUUKTZDKBPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene?
The IUPAC name of 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene (CID 143705761) is 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene.
What is the SMILES notation for 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene?
The canonical SMILES for 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene is C=C1CCC(=O)N1CCCNC1CCC(CN)CC1.Clc1ccccc1.
What is the InChIKey of 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene?
The InChIKey is KEYVUUKTZDKBPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O.C6H5Cl/c1-12-3-8-15(19)18(12)10-2-9-17-14-6-4-13(11-16)5-7-14;7-6-4-2-1-3-5-6/h13-14,17H,1-11,16H2;1-5H.
What are the key properties of 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene?
1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene has a molecular weight of 377.96 g/mol, XLogP of 3.96, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[[4-(aminomethyl)cyclohexyl]amino]propyl]-5-methylidenepyrrolidin-2-one;chlorobenzene is sourced from PubChem (CID 143705761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).