C24H34ClN5O — CID 143705811
4-(aminomethyl)-4-(3-chlorophenyl)-N-methylcyclohexan-1-amine;5-methanimidoyl-6-(propan-2-ylamino)pyridine-3-carbaldehyde (PubChem CID 143705811) has the molecular formula C24H34ClN5O and a molecular weight of 444.02 g/mol. Its IUPAC name is 4-(aminomethyl)-4-(3-chlorophenyl)-N-methylcyclohexan-1-amine;5-methanimidoyl-6-(propan-2-ylamino)pyridine-3-carbaldehyde.
| Compound Name | 4-(aminomethyl)-4-(3-chlorophenyl)-N-methylcyclohexan-1-amine;5-methanimidoyl-6-(propan-2-ylamino)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 143705811 |
| Molecular Formula | C24H34ClN5O |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 4-(aminomethyl)-4-(3-chlorophenyl)-N-methylcyclohexan-1-amine;5-methanimidoyl-6-(propan-2-ylamino)pyridine-3-carbaldehyde |
| SMILES | CNC1CCC(CN)(c2cccc(Cl)c2)CC1.[H]/N=C/c1cc(C=O)cnc1NC(C)C |
| InChI | InChI=1S/C14H21ClN2.C10H13N3O/c1-17-13-5-7-14(10-16,8-6-13)11-3-2-4-12(15)9-11;1-7(2)13-10-9(4-11)3-8(6-14)5-12-10/h2-4,9,13,17H,5-8,10,16H2,1H3;3-7,11H,1-2H3,(H,12,13)/b;11-4+ |
| InChIKey | MYRZLCGPZDSKNX-ANTNIJRQSA-N |
| XLogP | 4.41 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|