C18H26N4O — CID 143705955
4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one (PubChem CID 143705955) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one.
| Compound Name | 4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 143705955 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-amino-2-[4-(aminomethyl)cyclohexyl]-6-[(2E,4Z)-hepta-2,4,6-trien-3-yl]pyridazin-3-one |
| SMILES | C=C/C=C\C(=C/C)c1cc(N)c(=O)n(C2CCC(CN)CC2)n1 |
| InChI | InChI=1S/C18H26N4O/c1-3-5-6-14(4-2)17-11-16(20)18(23)22(21-17)15-9-7-13(12-19)8-10-15/h3-6,11,13,15H,1,7-10,12,19-20H2,2H3/b6-5-,14-4+ |
| InChIKey | BRSDPLFCSORAOC-NDJUKFIMSA-N |
| XLogP | 2.66 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|