About ethane;1-ethenoxybut-3-en-2-one;methane
ethane;1-ethenoxybut-3-en-2-one;methane (PubChem CID 143706209) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is ethane;1-ethenoxybut-3-en-2-one;methane.
Molecular Properties
| Compound Name | ethane;1-ethenoxybut-3-en-2-one;methane |
| PubChem CID | 143706209 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | ethane;1-ethenoxybut-3-en-2-one;methane |
| SMILES | C.C=COCC(=O)C=C.CC.CC |
| InChI | InChI=1S/C6H8O2.2C2H6.CH4/c1-3-6(7)5-8-4-2;2*1-2;/h3-4H,1-2,5H2;2*1-2H3;1H4 |
| InChIKey | WEJHULKLOVXQKA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethenoxybut-3-en-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenoxybut-3-en-2-one;methane?
The IUPAC name of ethane;1-ethenoxybut-3-en-2-one;methane (CID 143706209) is ethane;1-ethenoxybut-3-en-2-one;methane.
What is the SMILES notation for ethane;1-ethenoxybut-3-en-2-one;methane?
The canonical SMILES for ethane;1-ethenoxybut-3-en-2-one;methane is C.C=COCC(=O)C=C.CC.CC.
What is the InChIKey of ethane;1-ethenoxybut-3-en-2-one;methane?
The InChIKey is WEJHULKLOVXQKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.2C2H6.CH4/c1-3-6(7)5-8-4-2;2*1-2;/h3-4H,1-2,5H2;2*1-2H3;1H4.
What are the key properties of ethane;1-ethenoxybut-3-en-2-one;methane?
ethane;1-ethenoxybut-3-en-2-one;methane has a molecular weight of 188.31 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenoxybut-3-en-2-one;methane is sourced from PubChem (CID 143706209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).