About buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine
buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine (PubChem CID 143706238) has the molecular formula C12H27NS
and a molecular weight of 217.42 g/mol. Its IUPAC name is buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine.
Molecular Properties
| Compound Name | buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine |
| PubChem CID | 143706238 |
| Molecular Formula | C12H27NS |
| Molecular Weight | 217.42 g/mol |
| Exact Mass | 217.19 |
| IUPAC Name | buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine |
| SMILES | C=CC=C.C=CSN(C)C.CC.CC |
| InChI | InChI=1S/C4H9NS.C4H6.2C2H6/c1-4-6-5(2)3;1-3-4-2;2*1-2/h4H,1H2,2-3H3;3-4H,1-2H2;2*1-2H3 |
| InChIKey | GPUUHECQGJBMDN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine?
The IUPAC name of buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine (CID 143706238) is buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine.
What is the SMILES notation for buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine?
The canonical SMILES for buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine is C=CC=C.C=CSN(C)C.CC.CC.
What is the InChIKey of buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine?
The InChIKey is GPUUHECQGJBMDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NS.C4H6.2C2H6/c1-4-6-5(2)3;1-3-4-2;2*1-2/h4H,1H2,2-3H3;3-4H,1-2H2;2*1-2H3.
What are the key properties of buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine?
buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine has a molecular weight of 217.42 g/mol, XLogP of 4.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;ethane;N-ethenylsulfanyl-N-methylmethanamine is sourced from PubChem (CID 143706238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).