About ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one
ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one (PubChem CID 143707099) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one.
Molecular Properties
| Compound Name | ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one |
| PubChem CID | 143707099 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one |
| SMILES | CC.CCC(=O)c1ccn2ccnc2c1 |
| InChI | InChI=1S/C10H10N2O.C2H6/c1-2-9(13)8-3-5-12-6-4-11-10(12)7-8;1-2/h3-7H,2H2,1H3;1-2H3 |
| InChIKey | QLECIYRQUAPELP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one?
The IUPAC name of ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one (CID 143707099) is ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one.
What is the SMILES notation for ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one?
The canonical SMILES for ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one is CC.CCC(=O)c1ccn2ccnc2c1.
What is the InChIKey of ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one?
The InChIKey is QLECIYRQUAPELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.C2H6/c1-2-9(13)8-3-5-12-6-4-11-10(12)7-8;1-2/h3-7H,2H2,1H3;1-2H3.
What are the key properties of ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one?
ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one has a molecular weight of 204.27 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-imidazo[1,2-a]pyridin-7-ylpropan-1-one is sourced from PubChem (CID 143707099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).