C15H27NO — CID 143707490
(4Z,6Z)-1-(butylamino)-4-ethenyl-5-methylocta-4,6-dien-1-ol (PubChem CID 143707490) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (4Z,6Z)-1-(butylamino)-4-ethenyl-5-methylocta-4,6-dien-1-ol.
| Compound Name | (4Z,6Z)-1-(butylamino)-4-ethenyl-5-methylocta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 143707490 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (4Z,6Z)-1-(butylamino)-4-ethenyl-5-methylocta-4,6-dien-1-ol |
| SMILES | C=C/C(CCC(O)NCCCC)=C(C)\C=C/C |
| InChI | InChI=1S/C15H27NO/c1-5-8-12-16-15(17)11-10-14(7-3)13(4)9-6-2/h6-7,9,15-17H,3,5,8,10-12H2,1-2,4H3/b9-6-,14-13+ |
| InChIKey | NFEBGJUNNZYHKQ-VFMLYFKRSA-N |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|