C13H15F3O3 — CID 143707624
6-methyl-6-[2-(trifluoromethyl)prop-2-enoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 143707624) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is 6-methyl-6-[2-(trifluoromethyl)prop-2-enoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 6-methyl-6-[2-(trifluoromethyl)prop-2-enoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 143707624 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 6-methyl-6-[2-(trifluoromethyl)prop-2-enoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | C=C(C(=O)C1(C)CC2CC(C(=O)O)C1C2)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O3/c1-6(13(14,15)16)10(17)12(2)5-7-3-8(11(18)19)9(12)4-7/h7-9H,1,3-5H2,2H3,(H,18,19) |
| InChIKey | PLVDYPNBHAZJOJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|