C11H12O — CID 143707697
7-methyl-3-methylidene-4H-chromene (PubChem CID 143707697) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 7-methyl-3-methylidene-4H-chromene.
| Compound Name | 7-methyl-3-methylidene-4H-chromene |
|---|---|
| PubChem CID | 143707697 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 7-methyl-3-methylidene-4H-chromene |
| SMILES | C=C1COc2cc(C)ccc2C1 |
| InChI | InChI=1S/C11H12O/c1-8-3-4-10-5-9(2)7-12-11(10)6-8/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | FXTMXWKEACZGLQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|