About 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine
3-ethylsulfanyl-1,6-dimethyl-2H-pyridine (PubChem CID 143707852) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine |
| PubChem CID | 143707852 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine |
| SMILES | CCSC1=CC=C(C)N(C)C1 |
| InChI | InChI=1S/C9H15NS/c1-4-11-9-6-5-8(2)10(3)7-9/h5-6H,4,7H2,1-3H3 |
| InChIKey | HKVZZTBJOOBVKI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine?
The IUPAC name of 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine (CID 143707852) is 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine.
What is the SMILES notation for 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine?
The canonical SMILES for 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine is CCSC1=CC=C(C)N(C)C1.
What is the InChIKey of 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine?
The InChIKey is HKVZZTBJOOBVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS/c1-4-11-9-6-5-8(2)10(3)7-9/h5-6H,4,7H2,1-3H3.
What are the key properties of 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine?
3-ethylsulfanyl-1,6-dimethyl-2H-pyridine has a molecular weight of 169.29 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanyl-1,6-dimethyl-2H-pyridine is sourced from PubChem (CID 143707852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).