About (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene
(5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene (PubChem CID 143708021) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene.
Molecular Properties
| Compound Name | (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene |
| PubChem CID | 143708021 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene |
| SMILES | C=C/C=C1\C(=C)C(C)=NC2(C=C)CC12C |
| InChI | InChI=1S/C14H17N/c1-6-8-12-10(3)11(4)15-14(7-2)9-13(12,14)5/h6-8H,1-3,9H2,4-5H3/b12-8+ |
| InChIKey | YUEUOOFMYGXSFU-XYOKQWHBSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene?
The IUPAC name of (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene (CID 143708021) is (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene.
What is the SMILES notation for (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene?
The canonical SMILES for (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene is C=C/C=C1\C(=C)C(C)=NC2(C=C)CC12C.
What is the InChIKey of (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene?
The InChIKey is YUEUOOFMYGXSFU-XYOKQWHBSA-N. The full InChI is InChI=1S/C14H17N/c1-6-8-12-10(3)11(4)15-14(7-2)9-13(12,14)5/h6-8H,1-3,9H2,4-5H3/b12-8+.
What are the key properties of (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene?
(5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene has a molecular weight of 199.30 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-1-ethenyl-3,6-dimethyl-4-methylidene-5-prop-2-enylidene-2-azabicyclo[4.1.0]hept-2-ene is sourced from PubChem (CID 143708021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).