About 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid
4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid (PubChem CID 143708484) has the molecular formula C13H25N4O7P
and a molecular weight of 380.34 g/mol. Its IUPAC name is 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid.
Molecular Properties
| Compound Name | 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid |
| PubChem CID | 143708484 |
| Molecular Formula | C13H25N4O7P |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid |
| SMILES | CCC(COP(=O)(O)NC(C)C(=O)O)OC.Cn1ccc(N)nc1=O |
| InChI | InChI=1S/C8H18NO6P.C5H7N3O/c1-4-7(14-3)5-15-16(12,13)9-6(2)8(10)11;1-8-3-2-4(6)7-5(8)9/h6-7H,4-5H2,1-3H3,(H,10,11)(H2,9,12,13);2-3H,1H3,(H2,6,7,9) |
| InChIKey | CRPLYSNHDGSQBK-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid?
The IUPAC name of 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid (CID 143708484) is 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid.
What is the SMILES notation for 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid?
The canonical SMILES for 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid is CCC(COP(=O)(O)NC(C)C(=O)O)OC.Cn1ccc(N)nc1=O.
What is the InChIKey of 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid?
The InChIKey is CRPLYSNHDGSQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18NO6P.C5H7N3O/c1-4-7(14-3)5-15-16(12,13)9-6(2)8(10)11;1-8-3-2-4(6)7-5(8)9/h6-7H,4-5H2,1-3H3,(H,10,11)(H2,9,12,13);2-3H,1H3,(H2,6,7,9).
What are the key properties of 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid?
4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid has a molecular weight of 380.34 g/mol, XLogP of -0.05, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-methylpyrimidin-2-one;2-[[hydroxy(2-methoxybutoxy)phosphoryl]amino]propanoic acid is sourced from PubChem (CID 143708484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).