C23H20N6O2S — CID 143708761
N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 143708761) has the molecular formula C23H20N6O2S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 143708761 |
| Molecular Formula | C23H20N6O2S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)-3-imino-3-pyridin-3-ylpropyl]-4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | [H]/N=C(/CC(NC(=O)c1sc(-c2cnccn2)nc1C)c1ccccc1O)c1cccnc1 |
| InChI | InChI=1S/C23H20N6O2S/c1-14-21(32-23(28-14)19-13-26-9-10-27-19)22(31)29-18(16-6-2-3-7-20(16)30)11-17(24)15-5-4-8-25-12-15/h2-10,12-13,18,24,30H,11H2,1H3,(H,29,31)/b24-17- |
| InChIKey | GVSDHRDYCZHODS-ULJHMMPZSA-N |
| XLogP | 3.94 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|