C24H30N2O2 — CID 143709046
benzaldehyde;7-tert-butyl-2-(methoxymethyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline (PubChem CID 143709046) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is benzaldehyde;7-tert-butyl-2-(methoxymethyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline.
| Compound Name | benzaldehyde;7-tert-butyl-2-(methoxymethyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline |
|---|---|
| PubChem CID | 143709046 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | benzaldehyde;7-tert-butyl-2-(methoxymethyl)-5,6,7,8-tetrahydro-1H-pyrrolo[3,2-b]quinoline |
| SMILES | COCc1cc2nc3c(cc2[nH]1)CC(C(C)(C)C)CC3.O=Cc1ccccc1 |
| InChI | InChI=1S/C17H24N2O.C7H6O/c1-17(2,3)12-5-6-14-11(7-12)8-15-16(19-14)9-13(18-15)10-20-4;8-6-7-4-2-1-3-5-7/h8-9,12,18H,5-7,10H2,1-4H3;1-6H |
| InChIKey | DOVCJOHITXETLY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|