C19H27N — CID 143709170
2-[(Z)-(5-tert-butyl-2-methylidenecyclohexylidene)methyl]-5-ethenyl-3-methyl-1H-pyrrole (PubChem CID 143709170) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-[(Z)-(5-tert-butyl-2-methylidenecyclohexylidene)methyl]-5-ethenyl-3-methyl-1H-pyrrole.
| Compound Name | 2-[(Z)-(5-tert-butyl-2-methylidenecyclohexylidene)methyl]-5-ethenyl-3-methyl-1H-pyrrole |
|---|---|
| PubChem CID | 143709170 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2-[(Z)-(5-tert-butyl-2-methylidenecyclohexylidene)methyl]-5-ethenyl-3-methyl-1H-pyrrole |
| SMILES | C=Cc1cc(C)c(/C=C2/CC(C(C)(C)C)CCC2=C)[nH]1 |
| InChI | InChI=1S/C19H27N/c1-7-17-10-14(3)18(20-17)12-15-11-16(19(4,5)6)9-8-13(15)2/h7,10,12,16,20H,1-2,8-9,11H2,3-6H3/b15-12- |
| InChIKey | RMDXAVFCUZUJBN-QINSGFPZSA-N |
| XLogP | 5.75 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |