C24H24F3N7O — CID 143709678
2-N-[1-(4-morpholin-4-ylphenyl)ethyl]-4-[5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidine-2,5-diamine (PubChem CID 143709678) has the molecular formula C24H24F3N7O and a molecular weight of 483.50 g/mol. Its IUPAC name is 2-N-[1-(4-morpholin-4-ylphenyl)ethyl]-4-[5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidine-2,5-diamine.
| Compound Name | 2-N-[1-(4-morpholin-4-ylphenyl)ethyl]-4-[5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 143709678 |
| Molecular Formula | C24H24F3N7O |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 2-N-[1-(4-morpholin-4-ylphenyl)ethyl]-4-[5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]pyrimidine-2,5-diamine |
| SMILES | CC(Nc1ncc(N)c(-c2c[nH]c3ncc(C(F)(F)F)cc23)n1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H24F3N7O/c1-14(15-2-4-17(5-3-15)34-6-8-35-9-7-34)32-23-31-13-20(28)21(33-23)19-12-30-22-18(19)10-16(11-29-22)24(25,26)27/h2-5,10-14H,6-9,28H2,1H3,(H,29,30)(H,31,32,33) |
| InChIKey | SAAFXAHPQOYBON-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|