C12H22N4 — CID 143709690
ethane;5-methyl-N-(1-methylpyrrolidin-3-yl)pyrimidin-2-amine (PubChem CID 143709690) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is ethane;5-methyl-N-(1-methylpyrrolidin-3-yl)pyrimidin-2-amine.
| Compound Name | ethane;5-methyl-N-(1-methylpyrrolidin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143709690 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | ethane;5-methyl-N-(1-methylpyrrolidin-3-yl)pyrimidin-2-amine |
| SMILES | CC.Cc1cnc(NC2CCN(C)C2)nc1 |
| InChI | InChI=1S/C10H16N4.C2H6/c1-8-5-11-10(12-6-8)13-9-3-4-14(2)7-9;1-2/h5-6,9H,3-4,7H2,1-2H3,(H,11,12,13);1-2H3 |
| InChIKey | GDBPZJXVVXAPBS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |