About (Z)-N'-methyl-N-propylpent-2-enimidamide
(Z)-N'-methyl-N-propylpent-2-enimidamide (PubChem CID 143709707) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (Z)-N'-methyl-N-propylpent-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N'-methyl-N-propylpent-2-enimidamide |
| PubChem CID | 143709707 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (Z)-N'-methyl-N-propylpent-2-enimidamide |
| SMILES | CC/C=C\C(=N/C)NCCC |
| InChI | InChI=1S/C9H18N2/c1-4-6-7-9(10-3)11-8-5-2/h6-7H,4-5,8H2,1-3H3,(H,10,11)/b7-6- |
| InChIKey | HVPRIAQSZKZHPH-SREVYHEPSA-N |
| XLogP | 1.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-methyl-N-propylpent-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-methyl-N-propylpent-2-enimidamide?
The IUPAC name of (Z)-N'-methyl-N-propylpent-2-enimidamide (CID 143709707) is (Z)-N'-methyl-N-propylpent-2-enimidamide.
What is the SMILES notation for (Z)-N'-methyl-N-propylpent-2-enimidamide?
The canonical SMILES for (Z)-N'-methyl-N-propylpent-2-enimidamide is CC/C=C\C(=N/C)NCCC.
What is the InChIKey of (Z)-N'-methyl-N-propylpent-2-enimidamide?
The InChIKey is HVPRIAQSZKZHPH-SREVYHEPSA-N. The full InChI is InChI=1S/C9H18N2/c1-4-6-7-9(10-3)11-8-5-2/h6-7H,4-5,8H2,1-3H3,(H,10,11)/b7-6-.
What are the key properties of (Z)-N'-methyl-N-propylpent-2-enimidamide?
(Z)-N'-methyl-N-propylpent-2-enimidamide has a molecular weight of 154.26 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-methyl-N-propylpent-2-enimidamide is sourced from PubChem (CID 143709707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).