About 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen
1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen (PubChem CID 143709802) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen.
Molecular Properties
| Compound Name | 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen |
| PubChem CID | 143709802 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen |
| SMILES | CC(=O)C(=O)N1CCC(CN)CC1.[H][H] |
| InChI | InChI=1S/C9H16N2O2.H2/c1-7(12)9(13)11-4-2-8(6-10)3-5-11;/h8H,2-6,10H2,1H3;1H |
| InChIKey | ICIHXFCZHFSFEE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen?
The IUPAC name of 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen (CID 143709802) is 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen.
What is the SMILES notation for 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen?
The canonical SMILES for 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen is CC(=O)C(=O)N1CCC(CN)CC1.[H][H].
What is the InChIKey of 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen?
The InChIKey is ICIHXFCZHFSFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2.H2/c1-7(12)9(13)11-4-2-8(6-10)3-5-11;/h8H,2-6,10H2,1H3;1H.
What are the key properties of 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen?
1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen has a molecular weight of 186.25 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(aminomethyl)piperidin-1-yl]propane-1,2-dione;molecular hydrogen is sourced from PubChem (CID 143709802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).