About [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol
[(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol (PubChem CID 143710579) has the molecular formula C22H35NO2
and a molecular weight of 345.53 g/mol. Its IUPAC name is [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol |
| PubChem CID | 143710579 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol |
| SMILES | [H]/N=C/C[C@]1(CO)CC[C@H](c2ccc(CCCCCCOCC)cc2)C1 |
| InChI | InChI=1S/C22H35NO2/c1-2-25-16-6-4-3-5-7-19-8-10-20(11-9-19)21-12-13-22(17-21,18-24)14-15-23/h8-11,15,21,23-24H,2-7,12-14,16-18H2,1H3/b23-15+/t21-,22+/m0/s1 |
| InChIKey | IFNGIVSTDCPODO-RXRGDLQPSA-N |
| XLogP | 5.11 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol?
The IUPAC name of [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol (CID 143710579) is [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol.
What is the SMILES notation for [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol?
The canonical SMILES for [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol is [H]/N=C/C[C@]1(CO)CC[C@H](c2ccc(CCCCCCOCC)cc2)C1.
What is the InChIKey of [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol?
The InChIKey is IFNGIVSTDCPODO-RXRGDLQPSA-N. The full InChI is InChI=1S/C22H35NO2/c1-2-25-16-6-4-3-5-7-19-8-10-20(11-9-19)21-12-13-22(17-21,18-24)14-15-23/h8-11,15,21,23-24H,2-7,12-14,16-18H2,1H3/b23-15+/t21-,22+/m0/s1.
What are the key properties of [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol?
[(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol has a molecular weight of 345.53 g/mol, XLogP of 5.11, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-3-[4-(6-ethoxyhexyl)phenyl]-1-(2-iminoethyl)cyclopentyl]methanol is sourced from PubChem (CID 143710579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).