C22H32O3 — CID 143710627
(E)-1-(5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl)-4-methyloct-1-en-6-yn-3-one (PubChem CID 143710627) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (E)-1-(5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl)-4-methyloct-1-en-6-yn-3-one.
| Compound Name | (E)-1-(5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl)-4-methyloct-1-en-6-yn-3-one |
|---|---|
| PubChem CID | 143710627 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (E)-1-(5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl)-4-methyloct-1-en-6-yn-3-one |
| SMILES | CC#CCC(C)C(=O)/C=C/C1CCC2CC3(CC12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C22H32O3/c1-5-6-7-16(2)20(23)11-10-17-8-9-18-12-22(13-19(17)18)24-14-21(3,4)15-25-22/h10-11,16-19H,7-9,12-15H2,1-4H3/b11-10+ |
| InChIKey | LSBYEUGICYHVTE-ZHACJKMWSA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|