About 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole
3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole (PubChem CID 143710821) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole |
| PubChem CID | 143710821 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole |
| SMILES | C=C1CNN=C1/C=C/CC |
| InChI | InChI=1S/C8H12N2/c1-3-4-5-8-7(2)6-9-10-8/h4-5,9H,2-3,6H2,1H3/b5-4+ |
| InChIKey | BZJPPPOLZFRBQH-SNAWJCMRSA-N |
| XLogP | 1.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole?
The IUPAC name of 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole (CID 143710821) is 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole.
What is the SMILES notation for 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole?
The canonical SMILES for 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole is C=C1CNN=C1/C=C/CC.
What is the InChIKey of 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole?
The InChIKey is BZJPPPOLZFRBQH-SNAWJCMRSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-4-5-8-7(2)6-9-10-8/h4-5,9H,2-3,6H2,1H3/b5-4+.
What are the key properties of 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole?
3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole has a molecular weight of 136.20 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-1-enyl]-4-methylidene-1,5-dihydropyrazole is sourced from PubChem (CID 143710821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).