C18H24F2N2O — CID 143711850
(2Z,4Z,7E,9E)-9-(5-ethyl-1,2-dihydropyridin-3-yl)-3,8-difluoro-10-(methylamino)deca-2,4,7,9-tetraen-1-ol (PubChem CID 143711850) has the molecular formula C18H24F2N2O and a molecular weight of 322.40 g/mol. Its IUPAC name is (2Z,4Z,7E,9E)-9-(5-ethyl-1,2-dihydropyridin-3-yl)-3,8-difluoro-10-(methylamino)deca-2,4,7,9-tetraen-1-ol.
| Compound Name | (2Z,4Z,7E,9E)-9-(5-ethyl-1,2-dihydropyridin-3-yl)-3,8-difluoro-10-(methylamino)deca-2,4,7,9-tetraen-1-ol |
|---|---|
| PubChem CID | 143711850 |
| Molecular Formula | C18H24F2N2O |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (2Z,4Z,7E,9E)-9-(5-ethyl-1,2-dihydropyridin-3-yl)-3,8-difluoro-10-(methylamino)deca-2,4,7,9-tetraen-1-ol |
| SMILES | CCC1=CNCC(C(=C\NC)/C(F)=C\C/C=C\C(F)=C\CO)=C1 |
| InChI | InChI=1S/C18H24F2N2O/c1-3-14-10-15(12-22-11-14)17(13-21-2)18(20)7-5-4-6-16(19)8-9-23/h4,6-8,10-11,13,21-23H,3,5,9,12H2,1-2H3/b6-4-,16-8-,17-13+,18-7+ |
| InChIKey | KAGGASHFESRYIY-RIXKXJAKSA-N |
| XLogP | 3.56 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|