C30H22F4IN3O5S — CID 143711955
N-[2-fluoro-4-iodo-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 143711955) has the molecular formula C30H22F4IN3O5S and a molecular weight of 739.49 g/mol. Its IUPAC name is N-[2-fluoro-4-iodo-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-fluoro-4-iodo-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 143711955 |
| Molecular Formula | C30H22F4IN3O5S |
| Molecular Weight | 739.49 g/mol |
| Exact Mass | 739.03 |
| IUPAC Name | N-[2-fluoro-4-iodo-3-[5-[4-(2-methoxyethoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COCCOc1ccc(-c2cnc3[nH]cc(C(=O)c4c(I)ccc(NS(=O)(=O)c5ccc(C(F)(F)F)cc5)c4F)c3c2)cc1 |
| InChI | InChI=1S/C30H22F4IN3O5S/c1-42-12-13-43-20-6-2-17(3-7-20)18-14-22-23(16-37-29(22)36-15-18)28(39)26-24(35)10-11-25(27(26)31)38-44(40,41)21-8-4-19(5-9-21)30(32,33)34/h2-11,14-16,38H,12-13H2,1H3,(H,36,37) |
| InChIKey | AKAGQEGUZDPPGN-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.49 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|