About ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate
ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate (PubChem CID 143712035) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate.
Molecular Properties
| Compound Name | ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate |
| PubChem CID | 143712035 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate |
| SMILES | CCOS(=O)C1=CCC=C(OC(C)C)C=C1 |
| InChI | InChI=1S/C12H18O3S/c1-4-14-16(13)12-7-5-6-11(8-9-12)15-10(2)3/h6-10H,4-5H2,1-3H3 |
| InChIKey | RQDOJOUOJNLJSB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate?
The IUPAC name of ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate (CID 143712035) is ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate.
What is the SMILES notation for ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate?
The canonical SMILES for ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate is CCOS(=O)C1=CCC=C(OC(C)C)C=C1.
What is the InChIKey of ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate?
The InChIKey is RQDOJOUOJNLJSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-4-14-16(13)12-7-5-6-11(8-9-12)15-10(2)3/h6-10H,4-5H2,1-3H3.
What are the key properties of ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate?
ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate has a molecular weight of 242.34 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-propan-2-yloxycyclohepta-1,4,6-triene-1-sulfinate is sourced from PubChem (CID 143712035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).