About 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene
9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene (PubChem CID 143712062) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene.
Analyze 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
The IUPAC name of 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene (CID 143712062) is 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene.
What is the SMILES notation for 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
The canonical SMILES for 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene is CCCc1cnc2c(c1)C1CC1N2.
What is the InChIKey of 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
The InChIKey is RXZVCHHGSDYFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-2-3-7-4-9-8-5-10(8)13-11(9)12-6-7/h4,6,8,10H,2-3,5H2,1H3,(H,12,13).
What are the key properties of 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene?
9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene has a molecular weight of 174.25 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-propyl-5,7-diazatricyclo[4.4.0.02,4]deca-1(6),7,9-triene is sourced from PubChem (CID 143712062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).