C9H12F2O3S — CID 143712065
(3E,5E)-5-(difluoromethoxy)-3-methylsulfonylhepta-1,3,5-triene (PubChem CID 143712065) has the molecular formula C9H12F2O3S and a molecular weight of 238.25 g/mol. Its IUPAC name is (3E,5E)-5-(difluoromethoxy)-3-methylsulfonylhepta-1,3,5-triene.
| Compound Name | (3E,5E)-5-(difluoromethoxy)-3-methylsulfonylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143712065 |
| Molecular Formula | C9H12F2O3S |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | (3E,5E)-5-(difluoromethoxy)-3-methylsulfonylhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C(=C/C)OC(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C9H12F2O3S/c1-4-7(14-9(10)11)6-8(5-2)15(3,12)13/h4-6,9H,2H2,1,3H3/b7-4+,8-6+ |
| InChIKey | GCJORZXAIRYNIY-IJYBVRAASA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|